cas: 259214-55-6 — see every product listed under this CAS number, including other names
(1S,2R)-1-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-ethenylcyclopropanecarboxylic acid, 95% mix TBC as stabilizer, 95% mix TBC as stabilizer (CAS 259214-55-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113R3P-100mg |
| cas | 259214-55-6 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 765.20 Pln | |
| Chemat | 10g | 1245.20 Pln | |
| Chemat | 25g | 2430.80 Pln | |
| Chemat | 50g | 3971.60 Pln | |
| Chemat | 100g | 6362.00 Pln |
| purity | 95% mix TBC as stabilizer |
|---|---|
| delivery time | 3 weeks |
Trans-(1S,2R)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid (CAS 259214-55-6) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: trans-(1S,2R)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid. InChIKey: RFAQWADNTLIWMG-CPCISQLKSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | trans-(1S,2R)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid |
| InChIKey | RFAQWADNTLIWMG-CPCISQLKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@]1(C[C@@H]1C=C)C(=O)O |
Computed by PubChem (NCBI)