cas: 259214-55-6 — see every product listed under this CAS number, including other names
(1S,2R)-1-((tert-Butoxycarbonyl)amino)-2-vinylcyclopropanecarboxylic acid, 97% (CAS 259214-55-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F787709-250MG |
| cas | 259214-55-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 5g | 924.69 Pln | |
| Fluorochem | 10g | 1794.18 Pln | |
| Fluorochem | 25g | 4163.14 Pln | |
| Fluorochem | 100g | 11030.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Trans-(1S,2R)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid (CAS 259214-55-6) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: trans-(1S,2R)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid. InChIKey: RFAQWADNTLIWMG-CPCISQLKSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | trans-(1S,2R)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid |
| InChIKey | RFAQWADNTLIWMG-CPCISQLKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@]1(C[C@@H]1C=C)C(=O)O |
Computed by PubChem (NCBI)