(1S,2R)-rel-2-(methoxycarbonyl)cyclopropane-1-carboxylic acid 98%
cas: 31420-47-0 — see every product listed under this CAS number, including other names
(1S,2R)-rel-2-(methoxycarbonyl)cyclopropane-1-carboxylic acid 98% (CAS 31420-47-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A153858-100mg |
| cas | 31420-47-0 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 476.06 Pln | |
| Ambeed | 25g | 1638.62 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A153858 |
Cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid (CAS 31420-47-0) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid. InChIKey: IRRAJLZEAOBJIV-IUYQGCFVSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 144.12 g/mol |
| IUPAC name | cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid |
| InChIKey | IRRAJLZEAOBJIV-IUYQGCFVSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-Methyl (1R,2S)-1,2-cyclopropanedicarboxylate, (1S,2R)-2-(methoxycarbonyl)cyclopropane-1-carboxylic acid, (1S,2R)-2-(methoxycarbonyl)cyclopropanecarboxylic acid, (1S,2R)-rel-2-(methoxycarbonyl)cyclopropane-1-carboxylic acid, 1,2-Cyclopropanedicarboxylic acid, monomethyl ester, (1R,2S)-rel-, (1S,2R)-rel-2-(Methoxycarbonyl)cyclopropanecarboxylic Acid, Cis-2-methoxycarbonylcyclopropanecarboxylic Acid, cis-2-(Methoxycarbonyl)cyclopropane-1-carboxylic acid, (1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid, (1S,2R)-2-(Methoxycarbonyl)cyclopropane-1-carboxylic acid ee