cas: 31420-47-0 — see every product listed under this CAS number, including other names
(1S,2R)-rel-2-(methoxycarbonyl)cyclopropane-1-carboxylic acid, 97% (CAS 31420-47-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F516960-100MG |
| cas | 31420-47-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 456.11 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid (CAS 31420-47-0) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid. InChIKey: IRRAJLZEAOBJIV-IUYQGCFVSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 144.12 g/mol |
| IUPAC name | cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid |
| InChIKey | IRRAJLZEAOBJIV-IUYQGCFVSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)