cas: 21531-45-3 — see every product listed under this CAS number, including other names
(1S,3R)-3-Hydroxycyclohexane-1-carboxylic acid, 97% (CAS 21531-45-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F602838-250MG |
| cas | 21531-45-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 591.48 Pln | |
| Fluorochem | 500mg | 1075.68 Pln | |
| Fluorochem | 1g | 1440.14 Pln | |
| Fluorochem | 5g | 5048.24 Pln | |
| Fluorochem | 10g | 9249.89 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Cis-(1S,3R)-3-hydroxycyclohexane-1-carboxylic acid (CAS 21531-45-3) is a chemical compound with the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. IUPAC name: cis-(1S,3R)-3-hydroxycyclohexane-1-carboxylic acid. InChIKey: JBZDHFKPEDWWJC-NTSWFWBYSA-N.
| Molecular formula | C7H12O3 |
|---|---|
| Molecular weight | 144.17 g/mol |
| IUPAC name | cis-(1S,3R)-3-hydroxycyclohexane-1-carboxylic acid |
| InChIKey | JBZDHFKPEDWWJC-NTSWFWBYSA-N |
| SMILES | C1C[C@@H](C[C@@H](C1)O)C(=O)O |
Computed by PubChem (NCBI)