CAS 1821707-49-6 is the registry number for (1R,3R)-3-Hydroxycyclohexanecarboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Trans-(1R,3R)-3-hydroxycyclohexane-1-carboxylic acid (CAS 1821707-49-6) is a chemical compound with the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. IUPAC name: trans-(1R,3R)-3-hydroxycyclohexane-1-carboxylic acid. InChIKey: JBZDHFKPEDWWJC-PHDIDXHHSA-N.
| Molecular formula | C7H12O3 |
|---|---|
| Molecular weight | 144.17 g/mol |
| IUPAC name | trans-(1R,3R)-3-hydroxycyclohexane-1-carboxylic acid |
| InChIKey | JBZDHFKPEDWWJC-PHDIDXHHSA-N |
| SMILES | C1C[C@H](C[C@@H](C1)O)C(=O)O |
Computed by PubChem (NCBI)