cas: 1392745-43-5 — see every product listed under this CAS number, including other names
(1S,3S,4S)-Ethyl 4-((tert-butoxycarbonyl)amino)-3-hydroxycyclohexanecarboxylate, 97%, 97% (CAS 1392745-43-5) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112AMM-500mg |
| cas | 1392745-43-5 |
| size | 500mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 1802.00 Pln | |
| Chemat | 1g | 2656.40 Pln | |
| Chemat | 5g | 7835.60 Pln | |
| Chemat | 10g | 12976.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl (1S,3S,4S)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate (CAS 1392745-43-5) is a chemical compound with the molecular formula C14H25NO5 and a molecular weight of 287.35 g/mol. IUPAC name: ethyl (1S,3S,4S)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate. InChIKey: JOOLXBLTNBWCNP-DCAQKATOSA-N.
| Molecular formula | C14H25NO5 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | ethyl (1S,3S,4S)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate |
| InChIKey | JOOLXBLTNBWCNP-DCAQKATOSA-N |
| SMILES | CCOC(=O)[C@H]1CC[C@@H]([C@H](C1)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)