CAS 380429-42-5 appears in our catalog under these names: (2S,4R)-3-tert-Butyl 4-methyl 2-tert-butyloxazolidine-3,4-dicarboxylate, 95%, (2S,4R)-3-tert-Butyl 4-methyl 2-tert-butyloxazolidine-3,4-dicarboxylate, 98%, 98%, 3-(tert-Butyl) 4-methyl (2S,4R)-2-(tert-butyl)oxazolidine-3,4-dicarboxylate, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg.
3-O-tert-butyl 4-O-methyl (2S,4R)-2-tert-butyl-1,3-oxazolidine-3,4-dicarboxylate (CAS 380429-42-5) is a chemical compound with the molecular formula C14H25NO5 and a molecular weight of 287.35 g/mol. IUPAC name: 3-O-tert-butyl 4-O-methyl (2S,4R)-2-tert-butyl-1,3-oxazolidine-3,4-dicarboxylate. InChIKey: GZAZHWGEIRAXKK-KOLCDFICSA-N.
| Molecular formula | C14H25NO5 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | 3-O-tert-butyl 4-O-methyl (2S,4R)-2-tert-butyl-1,3-oxazolidine-3,4-dicarboxylate |
| InChIKey | GZAZHWGEIRAXKK-KOLCDFICSA-N |
| SMILES | CC(C)(C)[C@H]1N([C@H](CO1)C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)