cas: 60176-77-4 — see every product listed under this CAS number, including other names
(1S,4R)-Cis-4-acetoxy-2-cyclopenten-1-ol, 95%+, 95%+ (CAS 60176-77-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E0SD-100mg |
| cas | 60176-77-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 2128.40 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
[(1S,4R)-4-hydroxycyclopent-2-en-1-yl] acetate (CAS 60176-77-4) is a chemical compound with the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. IUPAC name: [(1S,4R)-4-hydroxycyclopent-2-en-1-yl] acetate. InChIKey: IJDYOKVVRXZCFD-NKWVEPMBSA-N.
| Molecular formula | C7H10O3 |
|---|---|
| Molecular weight | 142.15 g/mol |
| IUPAC name | [(1S,4R)-4-hydroxycyclopent-2-en-1-yl] acetate |
| InChIKey | IJDYOKVVRXZCFD-NKWVEPMBSA-N |
| SMILES | CC(=O)O[C@H]1C[C@H](C=C1)O |
Computed by PubChem (NCBI)