CAS 61348-01-4 is the registry number for 4-Cyclopentene-1,3-diol, monoacetate, (1s-tranS)- (9ci), 95%. Offered by: AmBeed. Available pack sizes: 1g.
[(1S,4S)-4-hydroxycyclopent-2-en-1-yl] acetate (CAS 61348-01-4) is a chemical compound with the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. IUPAC name: [(1S,4S)-4-hydroxycyclopent-2-en-1-yl] acetate. InChIKey: IJDYOKVVRXZCFD-RNFRBKRXSA-N.
| Molecular formula | C7H10O3 |
|---|---|
| Molecular weight | 142.15 g/mol |
| IUPAC name | [(1S,4S)-4-hydroxycyclopent-2-en-1-yl] acetate |
| InChIKey | IJDYOKVVRXZCFD-RNFRBKRXSA-N |
| SMILES | CC(=O)O[C@H]1C[C@@H](C=C1)O |
Computed by PubChem (NCBI)