CAS 60410-18-6 appears in our catalog under these names: Rel-(1R,4S)-4-Hydroxycyclopent-2-En-1-Yl Acetate, 97%, 97%, rel-(1R,4S)-4-Hydroxycyclopent-2-en-1-yl acetate, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
[(1R,4S)-4-hydroxycyclopent-2-en-1-yl] acetate (CAS 60410-18-6) is a chemical compound with the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. IUPAC name: [(1R,4S)-4-hydroxycyclopent-2-en-1-yl] acetate. InChIKey: IJDYOKVVRXZCFD-RQJHMYQMSA-N.
| Molecular formula | C7H10O3 |
|---|---|
| Molecular weight | 142.15 g/mol |
| IUPAC name | [(1R,4S)-4-hydroxycyclopent-2-en-1-yl] acetate |
| InChIKey | IJDYOKVVRXZCFD-RQJHMYQMSA-N |
| SMILES | CC(=O)O[C@@H]1C[C@@H](C=C1)O |
Computed by PubChem (NCBI)