cas: 76784-95-7 — see every product listed under this CAS number, including other names
(1alpha,2alpha,4alpha)-1,2,4-Cyclohexanetricarboxylic Acid, >98.0%(GC)(T) (CAS 76784-95-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C2062-5G |
| cas | 76784-95-7 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 251.11 Pln | |
| TCI | 25g | 875.60 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
(1S,2R,4R)-cyclohexane-1,2,4-tricarboxylic acid (CAS 76784-95-7) is a chemical compound with the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. IUPAC name: (1S,2R,4R)-cyclohexane-1,2,4-tricarboxylic acid. InChIKey: WTNDADANUZETTI-NGJCXOISSA-N.
| Molecular formula | C9H12O6 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | (1S,2R,4R)-cyclohexane-1,2,4-tricarboxylic acid |
| InChIKey | WTNDADANUZETTI-NGJCXOISSA-N |
| SMILES | C1C[C@@H]([C@@H](C[C@@H]1C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)