Products 4271-99-2
CAS 4271-99-2 appears in our catalog under these names: Trans-aconitic acid trimethyl ester, 95%, Trimethyl (E)-prop-1-ene-1,2,3-tricarboxylate, 97%, Trimethyl (E)-Aconitate, >95% (HPLC), Trimethyl trans–Aconitate, Trimethyl trans-Aconitate, >97.0%(GC). Offered by: Combi-blocks, AmBeed, TRC, GLPBio, TCI. Available pack sizes: 10g, 1g, 5g, 25g, 50g.
Trimethyl (E)-prop-1-ene-1,2,3-tricarboxylate (CAS 4271-99-2) is a chemical compound with the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. IUPAC name: trimethyl (E)-prop-1-ene-1,2,3-tricarboxylate. InChIKey: DZAIBGWGBBQGPZ-GQCTYLIASA-N.
| Molecular formula | C9H12O6 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | trimethyl (E)-prop-1-ene-1,2,3-tricarboxylate |
| InChIKey | DZAIBGWGBBQGPZ-GQCTYLIASA-N |
| SMILES | COC(=O)C/C(=C\C(=O)OC)/C(=O)OC |
Computed by PubChem (NCBI)