cas: 76784-95-7 — see every product listed under this CAS number, including other names
(1alpha,2alpha,4alpha)-1,2,4-Cyclohexanetricarboxylic Acid, ≥98%, ≥98% (CAS 76784-95-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BF4-1g |
| cas | 76784-95-7 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 371.60 Pln | |
| Chemat | 25g | 1034.00 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
(1S,2R,4R)-cyclohexane-1,2,4-tricarboxylic acid (CAS 76784-95-7) is a chemical compound with the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. IUPAC name: (1S,2R,4R)-cyclohexane-1,2,4-tricarboxylic acid. InChIKey: WTNDADANUZETTI-NGJCXOISSA-N.
| Molecular formula | C9H12O6 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | (1S,2R,4R)-cyclohexane-1,2,4-tricarboxylic acid |
| InChIKey | WTNDADANUZETTI-NGJCXOISSA-N |
| SMILES | C1C[C@@H]([C@@H](C[C@@H]1C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)