CAS 860649-42-9 is the registry number for 5-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3,4-dihydroxy-2(5h)-furanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(2,2-dimethyl-1,3-dioxolan-4-yl)-3,4-dihydroxy-2H-furan-5-one (CAS 860649-42-9) is a chemical compound with the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. IUPAC name: 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-3,4-dihydroxy-2H-furan-5-one. InChIKey: POXUQBFHDHCZAD-UHFFFAOYSA-N.
| Molecular formula | C9H12O6 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-3,4-dihydroxy-2H-furan-5-one |
| InChIKey | POXUQBFHDHCZAD-UHFFFAOYSA-N |
| SMILES | CC1(OCC(O1)C2C(=C(C(=O)O2)O)O)C |
Computed by PubChem (NCBI)