cas: 957060-82-1 — see every product listed under this CAS number, including other names
(2,3-Difluoro-5-nitrophenyl)boronic acid, 98% (CAS 957060-82-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210505-250MG |
| cas | 957060-82-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 476.93 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2,3-difluoro-5-nitrophenyl)boronic acid (CAS 957060-82-1) is a chemical compound with the molecular formula C6H4BF2NO4 and a molecular weight of 202.91 g/mol. IUPAC name: (2,3-difluoro-5-nitrophenyl)boronic acid. InChIKey: AARSYRVYLRWEBG-UHFFFAOYSA-N.
| Molecular formula | C6H4BF2NO4 |
|---|---|
| Molecular weight | 202.91 g/mol |
| IUPAC name | (2,3-difluoro-5-nitrophenyl)boronic acid |
| InChIKey | AARSYRVYLRWEBG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)F)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)