Products 325786-11-6

CAS 325786-11-6 is the registry number for 2,4-Difluoro-5-nitrophenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

(2,4-difluoro-5-nitrophenyl)boronic acid (CAS 325786-11-6) is a chemical compound with the molecular formula C6H4BF2NO4 and a molecular weight of 202.91 g/mol. IUPAC name: (2,4-difluoro-5-nitrophenyl)boronic acid. InChIKey: PSPLUVTUISDWMW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BF2NO4
Molecular weight202.91 g/mol
IUPAC name(2,4-difluoro-5-nitrophenyl)boronic acid
InChIKeyPSPLUVTUISDWMW-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1F)F)[N+](=O)[O-])(O)O

Computed by PubChem (NCBI)