CAS 325786-11-6 is the registry number for 2,4-Difluoro-5-nitrophenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
(2,4-difluoro-5-nitrophenyl)boronic acid (CAS 325786-11-6) is a chemical compound with the molecular formula C6H4BF2NO4 and a molecular weight of 202.91 g/mol. IUPAC name: (2,4-difluoro-5-nitrophenyl)boronic acid. InChIKey: PSPLUVTUISDWMW-UHFFFAOYSA-N.
| Molecular formula | C6H4BF2NO4 |
|---|---|
| Molecular weight | 202.91 g/mol |
| IUPAC name | (2,4-difluoro-5-nitrophenyl)boronic acid |
| InChIKey | PSPLUVTUISDWMW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)F)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)