Products 1150114-60-5
CAS 1150114-60-5 appears in our catalog under these names: (3,5-Difluoro-2-nitrophenyl)boronic acid, 96%, 3,5-Difluoro-2-nitrophenylboronic acid, 96%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
(3,5-difluoro-2-nitrophenyl)boronic acid (CAS 1150114-60-5) is a chemical compound with the molecular formula C6H4BF2NO4 and a molecular weight of 202.91 g/mol. IUPAC name: (3,5-difluoro-2-nitrophenyl)boronic acid. InChIKey: QSDKRMBLAFJYCE-UHFFFAOYSA-N.
| Molecular formula | C6H4BF2NO4 |
|---|---|
| Molecular weight | 202.91 g/mol |
| IUPAC name | (3,5-difluoro-2-nitrophenyl)boronic acid |
| InChIKey | QSDKRMBLAFJYCE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1[N+](=O)[O-])F)F)(O)O |
Computed by PubChem (NCBI)