CAS 1072952-06-7 appears in our catalog under these names: 3,4-Difluoro-5-nitrophenylboronic acid, 95%, (3,4-Difluoro-5-nitrophenyl)boronic acid 98+%, 3,4-Difluoro-5-nitrophenylboronic acid, 98+%, 98+%, (3,4-Difluoro-5-nitrophenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(3,4-difluoro-5-nitrophenyl)boronic acid (CAS 1072952-06-7) is a chemical compound with the molecular formula C6H4BF2NO4 and a molecular weight of 202.91 g/mol. IUPAC name: (3,4-difluoro-5-nitrophenyl)boronic acid. InChIKey: NUMAMIBIFPKICQ-UHFFFAOYSA-N.
| Molecular formula | C6H4BF2NO4 |
|---|---|
| Molecular weight | 202.91 g/mol |
| IUPAC name | (3,4-difluoro-5-nitrophenyl)boronic acid |
| InChIKey | NUMAMIBIFPKICQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)F)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)