CAS 685514-61-8 appears in our catalog under these names: (2,3–Dihydrobenzofuran–7–yl)boronic acid, (2,3-Dihydrobenzofuran-7-yl)boronic acid, 98%, 98%, 2,3-Dihydro-1-benzofuran-7-ylboronic acid, 98%, (2,3-Dihydrobenzofuran-7-yl)boronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g, 10g.
2,3-dihydro-1-benzofuran-7-ylboronic acid (CAS 685514-61-8) is a chemical compound with the molecular formula C8H9BO3 and a molecular weight of 163.97 g/mol. IUPAC name: 2,3-dihydro-1-benzofuran-7-ylboronic acid. InChIKey: JDOYUFYZFXCQJP-UHFFFAOYSA-N.
| Molecular formula | C8H9BO3 |
|---|---|
| Molecular weight | 163.97 g/mol |
| IUPAC name | 2,3-dihydro-1-benzofuran-7-ylboronic acid |
| InChIKey | JDOYUFYZFXCQJP-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)CCO2)(O)O |
Computed by PubChem (NCBI)