CAS 1186398-35-5 appears in our catalog under these names: 5-Formyl-2-methylphenylboronic acid, 98%, (5-Formyl-2-methylphenyl)boronic acid 95+%, 5-Formyl-2-methylphenylboronic acid, 95+%, 95+%, (5-Formyl-2-methylphenyl)boronic acid, 95+%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg.
(5-formyl-2-methylphenyl)boronic acid (CAS 1186398-35-5) is a chemical compound with the molecular formula C8H9BO3 and a molecular weight of 163.97 g/mol. IUPAC name: (5-formyl-2-methylphenyl)boronic acid. InChIKey: VBQDWWUYMAWKHV-UHFFFAOYSA-N.
| Molecular formula | C8H9BO3 |
|---|---|
| Molecular weight | 163.97 g/mol |
| IUPAC name | (5-formyl-2-methylphenyl)boronic acid |
| InChIKey | VBQDWWUYMAWKHV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C=O)C)(O)O |
Computed by PubChem (NCBI)