Products 870777-33-6
CAS 870777-33-6 appears in our catalog under these names: 3-Formyl-5-methylphenylboronic acid, 98%, 3–Formyl–5–methylphenylboronic acid(contains varying amounts of Anhydride), (3-Formyl-5-methylphenyl)boronic acid 97%, (3-Formyl-5-Methylphenyl)Boronic Acid, 95%, 95%, (3-Formyl-5-methylphenyl)boronic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 25g, 100mg, 250mg.
(3-formyl-5-methylphenyl)boronic acid (CAS 870777-33-6) is a chemical compound with the molecular formula C8H9BO3 and a molecular weight of 163.97 g/mol. IUPAC name: (3-formyl-5-methylphenyl)boronic acid. InChIKey: IDXLUNCVVBZUEN-UHFFFAOYSA-N.
| Molecular formula | C8H9BO3 |
|---|---|
| Molecular weight | 163.97 g/mol |
| IUPAC name | (3-formyl-5-methylphenyl)boronic acid |
| InChIKey | IDXLUNCVVBZUEN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C=O)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-Formyl-5-methylphenyl)boronic acid, 3-Formyl-5-methylphenylboronic acid, 3-Fornyl-5-methylphenylboronic acid, (3-Formyl-5-methylphenyl)boronicacid, (3-Formyl-5-methyl-phenyl)boronic acid, Boronic acid, B-(3-formyl-5-methylphenyl)-, 3-Formyl-5-methylphenyl boronic acid, 3-Formyl-5-methylphenylboronic acid(contains varying amounts of Anhydride)