CAS 631909-10-9 appears in our catalog under these names: 3-Formyl-2-methylphenylboronic acid, 96%, Boronic acid, (3-formyl-2-methylphenyl)- (9CI), ≥97.2%, ≥97.2%, (3-Formyl-2-methylphenyl)boronic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g.
(3-formyl-2-methylphenyl)boronic acid (CAS 631909-10-9) is a chemical compound with the molecular formula C8H9BO3 and a molecular weight of 163.97 g/mol. IUPAC name: (3-formyl-2-methylphenyl)boronic acid. InChIKey: PCMJTYJNVKJFBC-UHFFFAOYSA-N.
| Molecular formula | C8H9BO3 |
|---|---|
| Molecular weight | 163.97 g/mol |
| IUPAC name | (3-formyl-2-methylphenyl)boronic acid |
| InChIKey | PCMJTYJNVKJFBC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C=O)C)(O)O |
Computed by PubChem (NCBI)