cas: 1031438-93-3 — see every product listed under this CAS number, including other names
(2,3-Dimethoxypyridin-4-yl)boronic acid 98% (CAS 1031438-93-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A688779-100mg |
| cas | 1031438-93-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1638.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A688779 |
(2,3-dimethoxy-4-pyridinyl)boronic acid (CAS 1031438-93-3) is a chemical compound with the molecular formula C7H10BNO4 and a molecular weight of 182.97 g/mol. IUPAC name: (2,3-dimethoxy-4-pyridinyl)boronic acid. InChIKey: OTOWSMDVBDBKAX-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO4 |
|---|---|
| Molecular weight | 182.97 g/mol |
| IUPAC name | (2,3-dimethoxy-4-pyridinyl)boronic acid |
| InChIKey | OTOWSMDVBDBKAX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1)OC)OC)(O)O |
Computed by PubChem (NCBI)