Products 1031438-93-3

CAS 1031438-93-3 appears in our catalog under these names: 2,3-Dimethoxypyridine-4-boronic acid, 95%, (2,3-Dimethoxypyridin-4-yl)boronic acid 98%, 2,3-Dimethoxypyridine-4-boronic acid, 98%, 98%, (2,3-Dimethoxypyridin-4-yl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.

Structural formula: {0} (CAS {1})

(2,3-dimethoxy-4-pyridinyl)boronic acid (CAS 1031438-93-3) is a chemical compound with the molecular formula C7H10BNO4 and a molecular weight of 182.97 g/mol. IUPAC name: (2,3-dimethoxy-4-pyridinyl)boronic acid. InChIKey: OTOWSMDVBDBKAX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10BNO4
Molecular weight182.97 g/mol
IUPAC name(2,3-dimethoxy-4-pyridinyl)boronic acid
InChIKeyOTOWSMDVBDBKAX-UHFFFAOYSA-N
SMILESB(C1=C(C(=NC=C1)OC)OC)(O)O

Computed by PubChem (NCBI)