Products 1346526-61-1

CAS 1346526-61-1 appears in our catalog under these names: (5,6-Dimethoxypyridin-3-yl)boronic acid, 95%, (5,6-Dimethoxypyridin-3-yl)boronic acid 95%, (5,6-Dimethoxypyridin-3-yl)boronic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

(5,6-dimethoxy-3-pyridinyl)boronic acid (CAS 1346526-61-1) is a chemical compound with the molecular formula C7H10BNO4 and a molecular weight of 182.97 g/mol. IUPAC name: (5,6-dimethoxy-3-pyridinyl)boronic acid. InChIKey: WIFHLSYUKVVFMK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10BNO4
Molecular weight182.97 g/mol
IUPAC name(5,6-dimethoxy-3-pyridinyl)boronic acid
InChIKeyWIFHLSYUKVVFMK-UHFFFAOYSA-N
SMILESB(C1=CC(=C(N=C1)OC)OC)(O)O

Computed by PubChem (NCBI)