Products 1630193-77-9

CAS 1630193-77-9 appears in our catalog under these names: (2,5-dimethoxypyridin-4-yl)boronic acid, 95%, 2,5-Dimethoxypyridine-4-boronic acid, 2,5-Dimethoxypyridine-4-boronic Acid 95%, 2,5-Dimethoxypyridine-4-boronic acid, 95%, 95%, (2,5-DIMETHOXYPYRIDIN-4-YL)BORONIC ACID, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg.

Structural formula: {0} (CAS {1})

(2,5-dimethoxy-4-pyridinyl)boronic acid (CAS 1630193-77-9) is a chemical compound with the molecular formula C7H10BNO4 and a molecular weight of 182.97 g/mol. IUPAC name: (2,5-dimethoxy-4-pyridinyl)boronic acid. InChIKey: USYZNFPWBSJVMF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10BNO4
Molecular weight182.97 g/mol
IUPAC name(2,5-dimethoxy-4-pyridinyl)boronic acid
InChIKeyUSYZNFPWBSJVMF-UHFFFAOYSA-N
SMILESB(C1=CC(=NC=C1OC)OC)(O)O

Computed by PubChem (NCBI)