cas: 1160561-27-2 — see every product listed under this CAS number, including other names
(2,4-Dichloro-3-fluorophenyl)boronic acid, 97%, 97% (CAS 1160561-27-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K6E8-100mg |
| cas | 1160561-27-2 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 1g | 914.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,4-dichloro-3-fluorophenyl)boronic acid (CAS 1160561-27-2) is a chemical compound with the molecular formula C6H4BCl2FO2 and a molecular weight of 208.81 g/mol. IUPAC name: (2,4-dichloro-3-fluorophenyl)boronic acid. InChIKey: XPVWUAXQQRBFOX-UHFFFAOYSA-N.
| Molecular formula | C6H4BCl2FO2 |
|---|---|
| Molecular weight | 208.81 g/mol |
| IUPAC name | (2,4-dichloro-3-fluorophenyl)boronic acid |
| InChIKey | XPVWUAXQQRBFOX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)F)Cl)(O)O |
Computed by PubChem (NCBI)