2,4-Dichloro-3-fluorophenylboronic acid, 97%
cas: 1160561-27-2 — see every product listed under this CAS number, including other names
2,4-Dichloro-3-fluorophenylboronic acid, 97% (CAS 1160561-27-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627352-100MG |
| cas | 1160561-27-2 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 346.77 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 500mg | 685.19 Pln | |
| Fluorochem | 1g | 846.59 Pln | |
| Fluorochem | 5g | 2424.16 Pln | |
| Fluorochem | 10g | 4006.94 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2,4-dichloro-3-fluorophenyl)boronic acid (CAS 1160561-27-2) is a chemical compound with the molecular formula C6H4BCl2FO2 and a molecular weight of 208.81 g/mol. IUPAC name: (2,4-dichloro-3-fluorophenyl)boronic acid. InChIKey: XPVWUAXQQRBFOX-UHFFFAOYSA-N.
| Molecular formula | C6H4BCl2FO2 |
|---|---|
| Molecular weight | 208.81 g/mol |
| IUPAC name | (2,4-dichloro-3-fluorophenyl)boronic acid |
| InChIKey | XPVWUAXQQRBFOX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)F)Cl)(O)O |
Computed by PubChem (NCBI)