cas: 1256346-44-7 — see every product listed under this CAS number, including other names
(2,4-Dichloro-5-hydroxyphenyl)boronic acid, 96% (CAS 1256346-44-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A165097-10g |
| cas | 1256346-44-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 10902.64 Pln | |
| AmBeed | 5g | 7178.92 Pln |
| purity | 96% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2,4-dichloro-5-hydroxyphenyl)boronic acid (CAS 1256346-44-7) is a chemical compound with the molecular formula C6H5BCl2O3 and a molecular weight of 206.82 g/mol. IUPAC name: (2,4-dichloro-5-hydroxyphenyl)boronic acid. InChIKey: QGQYVVHOORCAAV-UHFFFAOYSA-N.
| Molecular formula | C6H5BCl2O3 |
|---|---|
| Molecular weight | 206.82 g/mol |
| IUPAC name | (2,4-dichloro-5-hydroxyphenyl)boronic acid |
| InChIKey | QGQYVVHOORCAAV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)Cl)O)(O)O |
Computed by PubChem (NCBI)