CAS 1701449-88-8 appears in our catalog under these names: (3,4-Dichloro-5-hydroxyphenyl)boronic acid, 98%, 98%, (3,4-Dichloro-5-hydroxyphenyl)boronic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3,4-dichloro-5-hydroxyphenyl)boronic acid (CAS 1701449-88-8) is a chemical compound with the molecular formula C6H5BCl2O3 and a molecular weight of 206.82 g/mol. IUPAC name: (3,4-dichloro-5-hydroxyphenyl)boronic acid. InChIKey: WBWHAZBJIKKVHE-UHFFFAOYSA-N.
| Molecular formula | C6H5BCl2O3 |
|---|---|
| Molecular weight | 206.82 g/mol |
| IUPAC name | (3,4-dichloro-5-hydroxyphenyl)boronic acid |
| InChIKey | WBWHAZBJIKKVHE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)Cl)O)(O)O |
Computed by PubChem (NCBI)