Products 1701449-88-8

CAS 1701449-88-8 appears in our catalog under these names: (3,4-Dichloro-5-hydroxyphenyl)boronic acid, 98%, 98%, (3,4-Dichloro-5-hydroxyphenyl)boronic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(3,4-dichloro-5-hydroxyphenyl)boronic acid (CAS 1701449-88-8) is a chemical compound with the molecular formula C6H5BCl2O3 and a molecular weight of 206.82 g/mol. IUPAC name: (3,4-dichloro-5-hydroxyphenyl)boronic acid. InChIKey: WBWHAZBJIKKVHE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BCl2O3
Molecular weight206.82 g/mol
IUPAC name(3,4-dichloro-5-hydroxyphenyl)boronic acid
InChIKeyWBWHAZBJIKKVHE-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1)Cl)Cl)O)(O)O

Computed by PubChem (NCBI)