Products 1028332-22-0

CAS 1028332-22-0 appears in our catalog under these names: (2,4-Dichloro-6-hydroxyphenyl)boronic acid, 97%, 97%, (2,4-Dichloro-6-hydroxyphenyl)boronic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g.

Structural formula: {0} (CAS {1})

(2,4-dichloro-6-hydroxyphenyl)boronic acid (CAS 1028332-22-0) is a chemical compound with the molecular formula C6H5BCl2O3 and a molecular weight of 206.82 g/mol. IUPAC name: (2,4-dichloro-6-hydroxyphenyl)boronic acid. InChIKey: HVUKPDHNOFEQKX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BCl2O3
Molecular weight206.82 g/mol
IUPAC name(2,4-dichloro-6-hydroxyphenyl)boronic acid
InChIKeyHVUKPDHNOFEQKX-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1Cl)Cl)O)(O)O

Computed by PubChem (NCBI)