CAS 1335048-35-5 appears in our catalog under these names: (3,5-Dichloro-4-hydroxyphenyl)boronic acid, 95%, (3,5-Dichloro-4-hydroxyphenyl)boronic acid 95%, (3,5-Dichloro-4-hydroxyphenyl)boronic acid, 95%, 95%, 3,5-DICHLORO-4-HYDROXYPHENYL BORONIC ACID, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(3,5-dichloro-4-hydroxyphenyl)boronic acid (CAS 1335048-35-5) is a chemical compound with the molecular formula C6H5BCl2O3 and a molecular weight of 206.82 g/mol. IUPAC name: (3,5-dichloro-4-hydroxyphenyl)boronic acid. InChIKey: PLWASSWLQMNNCS-UHFFFAOYSA-N.
| Molecular formula | C6H5BCl2O3 |
|---|---|
| Molecular weight | 206.82 g/mol |
| IUPAC name | (3,5-dichloro-4-hydroxyphenyl)boronic acid |
| InChIKey | PLWASSWLQMNNCS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)O)Cl)(O)O |
Computed by PubChem (NCBI)