(2,4-Dichloro-6-hydroxyphenyl)boronic acid, 97%
cas: 1028332-22-0 — see every product listed under this CAS number, including other names
(2,4-Dichloro-6-hydroxyphenyl)boronic acid, 97% (CAS 1028332-22-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F720529-250MG |
| cas | 1028332-22-0 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 919.49 Pln | |
| Fluorochem | 5g | 7724.38 Pln | |
| Ambeed | 250mg | 704.12 Pln | |
| Ambeed | 1g | 1816.62 Pln | |
| Ambeed | 5g | 6261.06 Pln | |
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 635.60 Pln | |
| Chemat | 5g | 5493.20 Pln | |
| BLDpharm | 100mg | 497.63 Pln | |
| BLDpharm | 250mg | 753.09 Pln | |
| BLDpharm | 1g | 1952.67 Pln | |
| BLDpharm | 5g | 6745.43 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
(2,4-dichloro-6-hydroxyphenyl)boronic acid (CAS 1028332-22-0) is a chemical compound with the molecular formula C6H5BCl2O3 and a molecular weight of 206.82 g/mol. IUPAC name: (2,4-dichloro-6-hydroxyphenyl)boronic acid. InChIKey: HVUKPDHNOFEQKX-UHFFFAOYSA-N.
| Molecular formula | C6H5BCl2O3 |
|---|---|
| Molecular weight | 206.82 g/mol |
| IUPAC name | (2,4-dichloro-6-hydroxyphenyl)boronic acid |
| InChIKey | HVUKPDHNOFEQKX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1Cl)Cl)O)(O)O |
Computed by PubChem (NCBI)