cas: 19811-05-3 — see every product listed under this CAS number, including other names
(2,4-Dichlorophenyl)(phenyl)methanone (CAS 19811-05-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219154-1G |
| cas | 19811-05-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 25g | 857.01 Pln |
| delivery time | 3-4 weeks |
|---|
(2,4-dichlorophenyl)-phenylmethanone (CAS 19811-05-3) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: (2,4-dichlorophenyl)-phenylmethanone. InChIKey: VLTYTTRXESKBKI-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | (2,4-dichlorophenyl)-phenylmethanone |
| InChIKey | VLTYTTRXESKBKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)