Products 6284-79-3
CAS 6284-79-3 appears in our catalog under these names: 3,4-Dichlorobenzophenone, 95%, 3,4-Dichlorobenzophenone, 3,4–Dichlorobenzophenone, 3,4-Dichlorobenzophenone, >98.0%(GC), (3,4-Dichlorophenyl)(phenyl)methanone 98%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 1g, 100g, 500g, 25g, 5g, 2,5g, 1x250mg.
(3,4-dichlorophenyl)-phenylmethanone (CAS 6284-79-3) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: (3,4-dichlorophenyl)-phenylmethanone. InChIKey: LLUPHTAYNHAVQT-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | (3,4-dichlorophenyl)-phenylmethanone |
| InChIKey | LLUPHTAYNHAVQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
3,4-Dichlorobenzophenone, (3,4-Dichlorophenyl)(phenyl)methanone, Methanone, (3,4-dichlorophenyl)phenyl-, Benzophenone, 3,4-dichloro-, (3,4-dichlorophenyl)-phenylmethanone, 3,4-Dichlorophenyl phenyl ketone, Benzophenone,4-dichloro-, (3,4-dichlorophenyl)-p, Methanone,4-dichlorophenyl)phenyl-, 3,4-Dichlorobenzophenone, AldrichCPR