Products 16611-67-9
CAS 16611-67-9 appears in our catalog under these names: 2,5-Dichlorobenzophenone, 97%, 2,5–Dichlorobenzophenone, (2,5-Dichlorophenyl)(phenyl)methanone 98%, (2,5-Dichlorophenyl)(phenyl)methanone, 97%, 97%, 2,5-Dichlorobenzophenone, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 500g, 5g, 1000g, 1kg.
(2,5-dichlorophenyl)-phenylmethanone (CAS 16611-67-9) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: (2,5-dichlorophenyl)-phenylmethanone. InChIKey: FAVKIHMGRWRACA-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | (2,5-dichlorophenyl)-phenylmethanone |
| InChIKey | FAVKIHMGRWRACA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)