CAS 5293-97-0 appears in our catalog under these names: 2,2'-Dichlorobenzophenone, 95%, 2,2'-Dichlorobenzophenone, 98+% , 2,2'-dichlorobenzophenone, Bis(2-chlorophenyl)methanone. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Chemat. Available pack sizes: 1g, 5g.
Bis(2-chlorophenyl)methanone (CAS 5293-97-0) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: bis(2-chlorophenyl)methanone. InChIKey: DRDRZHJTTDSOPK-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | bis(2-chlorophenyl)methanone |
| InChIKey | DRDRZHJTTDSOPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=CC=C2Cl)Cl |
Computed by PubChem (NCBI)