cas: 462059-71-8 — see every product listed under this CAS number, including other names
(2,4-Dimethoxybenzyl)hydrazine hydrochloride 95% (CAS 462059-71-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A194322-100mg |
| cas | 462059-71-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 620.69 Pln | |
| Ambeed | 1g | 1282.62 Pln | |
| Ambeed | 5g | 3691.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A194322 |
(2,4-dimethoxyphenyl)methylhydrazine;hydrochloride (CAS 462059-71-8) is a chemical compound with the molecular formula C9H15ClN2O2 and a molecular weight of 218.68 g/mol. IUPAC name: (2,4-dimethoxyphenyl)methylhydrazine;hydrochloride. InChIKey: JCIAZIMKVLPKFW-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN2O2 |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | (2,4-dimethoxyphenyl)methylhydrazine;hydrochloride |
| InChIKey | JCIAZIMKVLPKFW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CNN)OC.Cl |
Computed by PubChem (NCBI)