(2,6-Difluoro-3-nitrophenyl)boronic acid, 95%
cas: 1150114-28-5 — see every product listed under this CAS number, including other names
(2,6-Difluoro-3-nitrophenyl)boronic acid, 95% (CAS 1150114-28-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A373377-250mg |
| cas | 1150114-28-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 637.38 Pln | |
| Ambeed | 25g | 2823.44 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 281.04 Pln | |
| BLDpharm | 5g | 625.36 Pln | |
| BLDpharm | 25g | 2830.14 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2,6-difluoro-3-nitrophenyl)boronic acid (CAS 1150114-28-5) is a chemical compound with the molecular formula C6H4BF2NO4 and a molecular weight of 202.91 g/mol. IUPAC name: (2,6-difluoro-3-nitrophenyl)boronic acid. InChIKey: SPEDPBJIXAVPMJ-UHFFFAOYSA-N.
| Molecular formula | C6H4BF2NO4 |
|---|---|
| Molecular weight | 202.91 g/mol |
| IUPAC name | (2,6-difluoro-3-nitrophenyl)boronic acid |
| InChIKey | SPEDPBJIXAVPMJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)[N+](=O)[O-])F)(O)O |
Computed by PubChem (NCBI)