cas: 1220188-37-3 — see every product listed under this CAS number, including other names
(2,6-Dimethoxypyridin-4-yl)boronic acid, 98%, 98% (CAS 1220188-37-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HGKT-100mg |
| cas | 1220188-37-3 |
| size | 100mg |
| availability | 1.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 918.80 Pln | |
| Chemat | 250mg | 1514.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,6-dimethoxy-4-pyridinyl)boronic acid (CAS 1220188-37-3) is a chemical compound with the molecular formula C7H10BNO4 and a molecular weight of 182.97 g/mol. IUPAC name: (2,6-dimethoxy-4-pyridinyl)boronic acid. InChIKey: LVPPPYUWMHROKN-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO4 |
|---|---|
| Molecular weight | 182.97 g/mol |
| IUPAC name | (2,6-dimethoxy-4-pyridinyl)boronic acid |
| InChIKey | LVPPPYUWMHROKN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)OC)OC)(O)O |
Computed by PubChem (NCBI)