cas: 815581-79-4 — see every product listed under this CAS number, including other names
(2-((2,2,6,6-Tetramethylpiperidin-1-yl)methyl)phenyl)boronic acid, 98.0%, 98.0% (CAS 815581-79-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G0L4-100mg |
| cas | 815581-79-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 462.80 Pln | |
| Chemat | 1g | 861.20 Pln |
| purity | 98.0% |
|---|---|
| delivery time | 3 weeks |
[2-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]phenyl]boronic acid (CAS 815581-79-4) is a chemical compound with the molecular formula C16H26BNO2 and a molecular weight of 275.2 g/mol. IUPAC name: [2-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]phenyl]boronic acid. InChIKey: DOZVPMCVRDTTJK-UHFFFAOYSA-N.
| Molecular formula | C16H26BNO2 |
|---|---|
| Molecular weight | 275.2 g/mol |
| IUPAC name | [2-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]phenyl]boronic acid |
| InChIKey | DOZVPMCVRDTTJK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1CN2C(CCCC2(C)C)(C)C)(O)O |
Computed by PubChem (NCBI)