cas: 815581-79-4 — see every product listed under this CAS number, including other names
2-[(2,2,6,6-Tetramethyl-1-piperidyl)methyl]phenylboronic Acid (contains varying amounts of Anhydride), >98.0%(HPLC)(T) (CAS 815581-79-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T2908-1G |
| cas | 815581-79-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 1150.97 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
[2-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]phenyl]boronic acid (CAS 815581-79-4) is a chemical compound with the molecular formula C16H26BNO2 and a molecular weight of 275.2 g/mol. IUPAC name: [2-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]phenyl]boronic acid. InChIKey: DOZVPMCVRDTTJK-UHFFFAOYSA-N.
| Molecular formula | C16H26BNO2 |
|---|---|
| Molecular weight | 275.2 g/mol |
| IUPAC name | [2-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]phenyl]boronic acid |
| InChIKey | DOZVPMCVRDTTJK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1CN2C(CCCC2(C)C)(C)C)(O)O |
Computed by PubChem (NCBI)