cas: 327096-48-0 — see every product listed under this CAS number, including other names
(2-((Phenylamino)methyl)phenyl)boronic acid, 98% (CAS 327096-48-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A544583-10g |
| cas | 327096-48-0 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 6339.13 Pln | |
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 732.05 Pln | |
| Fluorochem | 1g | 1637.98 Pln | |
| Fluorochem | 5g | 2351.27 Pln | |
| Fluorochem | 10g | 3954.88 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
[2-(anilinomethyl)phenyl]boronic acid (CAS 327096-48-0) is a chemical compound with the molecular formula C13H14BNO2 and a molecular weight of 227.07 g/mol. IUPAC name: [2-(anilinomethyl)phenyl]boronic acid. InChIKey: UJYAVJBKHOWFPB-UHFFFAOYSA-N.
| Molecular formula | C13H14BNO2 |
|---|---|
| Molecular weight | 227.07 g/mol |
| IUPAC name | [2-(anilinomethyl)phenyl]boronic acid |
| InChIKey | UJYAVJBKHOWFPB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1CNC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)