CAS 2225172-29-0 is the registry number for 2–(4–Ethylphenyl)pyridine–4–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-(4-ethylphenyl)-4-pyridinyl]boronic acid (CAS 2225172-29-0) is a chemical compound with the molecular formula C13H14BNO2 and a molecular weight of 227.07 g/mol. IUPAC name: [2-(4-ethylphenyl)-4-pyridinyl]boronic acid. InChIKey: YNAYVWCZIFWMQN-UHFFFAOYSA-N.
| Molecular formula | C13H14BNO2 |
|---|---|
| Molecular weight | 227.07 g/mol |
| IUPAC name | [2-(4-ethylphenyl)-4-pyridinyl]boronic acid |
| InChIKey | YNAYVWCZIFWMQN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC=C1)C2=CC=C(C=C2)CC)(O)O |
Computed by PubChem (NCBI)