cas: 209396-01-0 — see every product listed under this CAS number, including other names
(2-((benzyl(methyl)amino)methyl)phenyl)boronic acid, 95%, 95% (CAS 209396-01-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FNNG-250mg |
| cas | 209396-01-0 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 942.80 Pln | |
| Chemat | 1g | 1782.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[2-[[benzyl(methyl)amino]methyl]phenyl]boronic acid (CAS 209396-01-0) is a chemical compound with the molecular formula C15H18BNO2 and a molecular weight of 255.12 g/mol. IUPAC name: [2-[[benzyl(methyl)amino]methyl]phenyl]boronic acid. InChIKey: QYNYPLPKQXXLQM-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO2 |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | [2-[[benzyl(methyl)amino]methyl]phenyl]boronic acid |
| InChIKey | QYNYPLPKQXXLQM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1CN(C)CC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)