CAS 171364-85-5 appears in our catalog under these names: Quinoline-3-boronic acid, pinacol ester, 96%, 3–Quinolineboronic acid pinacol ester, 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline, >98.0%(GC)(T), 3-Quinolineboronic acid pinacol ester, 97%, 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline 98%. Offered by: Combi-blocks, GLPBio, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 25g, 100g, 5g, 1g, 250mg, 10g.
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 171364-85-5) is a chemical compound with the molecular formula C15H18BNO2 and a molecular weight of 255.12 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: ARRJAONCYUAPJR-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO2 |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | ARRJAONCYUAPJR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=CC=CC=C3N=C2 |
Computed by PubChem (NCBI)