CAS 1021868-08-5 appears in our catalog under these names: 5–Quinolineboronic Acid Pinacol Ester, 5-Quinolineboronic Acid Pinacol Ester 98%, 5-QUINOLINEBORONIC ACID PINACOL ESTER, 98%, 5-Quinolineboronic Acid Pinacol Ester, 98%, 98%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 5g, 1g, 10g, 2.5g, 100mg.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 1021868-08-5) is a chemical compound with the molecular formula C15H18BNO2 and a molecular weight of 255.12 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: YXRNJSUZRJEHPV-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO2 |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | YXRNJSUZRJEHPV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CC=NC3=CC=C2 |
Computed by PubChem (NCBI)