CAS 406463-06-7 appears in our catalog under these names: 6–Quinolineboronic acid pinacol ester, 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline, >98.0%(GC)(T), 6-Quinolineboronic acid pinacol ester, 97%, 6-Quinolineboronic acid pinacol ester 98%, 6-QUINOLINEBORONIC ACID PINACOL ESTER, 9. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 406463-06-7) is a chemical compound with the molecular formula C15H18BNO2 and a molecular weight of 255.12 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: VMFALDWCEQUFSX-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO2 |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | VMFALDWCEQUFSX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N=CC=C3 |
Computed by PubChem (NCBI)