cas: 792158-57-7 — see every product listed under this CAS number, including other names
(2-(4-Chlorophenoxy)phenyl)methanamine, 97% (CAS 792158-57-7) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F776091-500MG |
| cas | 792158-57-7 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1101.71 Pln | |
| Fluorochem | 1g | 1841.04 Pln | |
| Fluorochem | 5g | 5948.96 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[2-(4-chlorophenoxy)phenyl]methanamine (CAS 792158-57-7) is a chemical compound with the molecular formula C13H12ClNO and a molecular weight of 233.69 g/mol. IUPAC name: [2-(4-chlorophenoxy)phenyl]methanamine. InChIKey: IAXVDWCOADTYIX-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | [2-(4-chlorophenoxy)phenyl]methanamine |
| InChIKey | IAXVDWCOADTYIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)